3C-E
| 3C-E | |
|---|---|
| Chemical name | 3,5-Dimethoxy-4-ethoxy-amphetamine or 1-(4-ethoxy-3,5-dimethoxyphenyl)propan-2-amine |
| Chemical formula | C13H21NO3 |
| Molecular mass | 239.31 g/mol |
| Melting point | - |
| CAS number | 146849–92–5 |
| SMILES | NC(C)CC1=CC(OC)=C(OCC)C(OC)=C1 |
3C-E is a psychedelic hallucinogenic drug and entheogen of the phenethylamine class of compounds. 3C-E was probably first synthesized by Alexander Shulgin. In his book PiHKAL (Phenethylamines I Have Known and Loved), Shulgin lists the dosage range as 30 to 60 mg, consumed orally. The duration of action was stated to be 8–12 hours. 3C-E is illegal in the US as a result of the Analogue Act, and is also illegal in Australia.
This compound is the three-carbon chain analogue of escaline.
External links
Categorization
| Hallucinogenic phenethylamines edit |
|---|
|
{2C-B} {2C-C} {2C-D} {2C-E} {2C-I} {2C-N} {2C-P} {2C-T-2} {2C-T-21} {2C-T-4} {2C-T-7} {2C-T-8} {3C-E} {Br-DFLY} {DOB} {DOI} {DOM} {Escaline} {MDA} {MDBD} {MDEA} {Mescaline} {TMA} |
Categories: Entactogens and Empathogens | Hallucinogenic phenethylamines | Chemistry stubs